C42H80N2O2 — CID 6296113
(E)-N-[6-[[(E)-octadec-9-enoyl]amino]hexyl]octadec-9-enamide (PubChem CID 6296113) has the molecular formula C42H80N2O2 and a molecular weight of 645.11 g/mol. Its IUPAC name is (E)-N-[6-[[(E)-octadec-9-enoyl]amino]hexyl]octadec-9-enamide.
| Compound Name | (E)-N-[6-[[(E)-octadec-9-enoyl]amino]hexyl]octadec-9-enamide |
|---|---|
| PubChem CID | 6296113 |
| Molecular Formula | C42H80N2O2 |
| Molecular Weight | 645.11 g/mol |
| Exact Mass | 644.62 |
| IUPAC Name | (E)-N-[6-[[(E)-octadec-9-enoyl]amino]hexyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)NCCCCCCNC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C42H80N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-33-37-41(45)43-39-35-31-32-36-40-44-42(46)38-34-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-40H2,1-2H3,(H,43,45)(H,44,46)/b19-17+,20-18+ |
| InChIKey | QRIKMBDKRJXWBV-XPWSMXQVSA-N |
| XLogP | 12.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.11 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|