About 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol
2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol (PubChem CID 62961190) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol |
| PubChem CID | 62961190 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol |
| SMILES | CCc1csc(NC2CCCCC2O)n1 |
| InChI | InChI=1S/C11H18N2OS/c1-2-8-7-15-11(12-8)13-9-5-3-4-6-10(9)14/h7,9-10,14H,2-6H2,1H3,(H,12,13) |
| InChIKey | SGYZYXQRIXVKMN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol?
The IUPAC name of 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol (CID 62961190) is 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol.
What is the SMILES notation for 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol?
The canonical SMILES for 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol is CCc1csc(NC2CCCCC2O)n1.
What is the InChIKey of 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol?
The InChIKey is SGYZYXQRIXVKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-2-8-7-15-11(12-8)13-9-5-3-4-6-10(9)14/h7,9-10,14H,2-6H2,1H3,(H,12,13).
What are the key properties of 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol?
2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol has a molecular weight of 226.34 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethyl-1,3-thiazol-2-yl)amino]cyclohexan-1-ol is sourced from PubChem (CID 62961190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).