About 4-amino-6-methyloctanoic acid
4-amino-6-methyloctanoic acid (PubChem CID 62961694) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-amino-6-methyloctanoic acid.
Molecular Properties
| Compound Name | 4-amino-6-methyloctanoic acid |
| PubChem CID | 62961694 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 4-amino-6-methyloctanoic acid |
| SMILES | CCC(C)CC(N)CCC(=O)O |
| InChI | InChI=1S/C9H19NO2/c1-3-7(2)6-8(10)4-5-9(11)12/h7-8H,3-6,10H2,1-2H3,(H,11,12) |
| InChIKey | HTXOBAZAERPCKP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-6-methyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-methyloctanoic acid?
The IUPAC name of 4-amino-6-methyloctanoic acid (CID 62961694) is 4-amino-6-methyloctanoic acid.
What is the SMILES notation for 4-amino-6-methyloctanoic acid?
The canonical SMILES for 4-amino-6-methyloctanoic acid is CCC(C)CC(N)CCC(=O)O.
What is the InChIKey of 4-amino-6-methyloctanoic acid?
The InChIKey is HTXOBAZAERPCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-3-7(2)6-8(10)4-5-9(11)12/h7-8H,3-6,10H2,1-2H3,(H,11,12).
What are the key properties of 4-amino-6-methyloctanoic acid?
4-amino-6-methyloctanoic acid has a molecular weight of 173.26 g/mol, XLogP of 1.61, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-methyloctanoic acid is sourced from PubChem (CID 62961694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).