C17H20N2S — CID 62962024
2-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]cyclopentane-1-carbonitrile (PubChem CID 62962024) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 2-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]cyclopentane-1-carbonitrile.
| Compound Name | 2-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 62962024 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]cyclopentane-1-carbonitrile |
| SMILES | Cc1c(C(C)NC2CCCC2C#N)sc2ccccc12 |
| InChI | InChI=1S/C17H20N2S/c1-11-14-7-3-4-9-16(14)20-17(11)12(2)19-15-8-5-6-13(15)10-18/h3-4,7,9,12-13,15,19H,5-6,8H2,1-2H3 |
| InChIKey | WFSYPROWJKTKFO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |