About N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide
N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide (PubChem CID 62962153) has the molecular formula C9H11F3N2O
and a molecular weight of 220.19 g/mol. Its IUPAC name is N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide |
| PubChem CID | 62962153 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide |
| SMILES | N#CC1CCCC1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O/c10-9(11,12)4-8(15)14-7-3-1-2-6(7)5-13/h6-7H,1-4H2,(H,14,15) |
| InChIKey | BMHYKHQKCCTXAT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide?
The IUPAC name of N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide (CID 62962153) is N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide?
The canonical SMILES for N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide is N#CC1CCCC1NC(=O)CC(F)(F)F.
What is the InChIKey of N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide?
The InChIKey is BMHYKHQKCCTXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O/c10-9(11,12)4-8(15)14-7-3-1-2-6(7)5-13/h6-7H,1-4H2,(H,14,15).
What are the key properties of N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide?
N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide has a molecular weight of 220.19 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanocyclopentyl)-3,3,3-trifluoropropanamide is sourced from PubChem (CID 62962153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).