About 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid
5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 62962247) has the molecular formula C12H14N2O3S
and a molecular weight of 266.32 g/mol. Its IUPAC name is 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid |
| PubChem CID | 62962247 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | CCc1csc(NCc2cc(C(=O)O)c(C)o2)n1 |
| InChI | InChI=1S/C12H14N2O3S/c1-3-8-6-18-12(14-8)13-5-9-4-10(11(15)16)7(2)17-9/h4,6H,3,5H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | DOVJMBHMYRFDQP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid?
The IUPAC name of 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid (CID 62962247) is 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid.
What is the SMILES notation for 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid?
The canonical SMILES for 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid is CCc1csc(NCc2cc(C(=O)O)c(C)o2)n1.
What is the InChIKey of 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid?
The InChIKey is DOVJMBHMYRFDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3S/c1-3-8-6-18-12(14-8)13-5-9-4-10(11(15)16)7(2)17-9/h4,6H,3,5H2,1-2H3,(H,13,14)(H,15,16).
What are the key properties of 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid?
5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid has a molecular weight of 266.32 g/mol, XLogP of 2.92, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]-2-methylfuran-3-carboxylic acid is sourced from PubChem (CID 62962247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).