About 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol
2-propoxy-1-(2,3,4-trifluorophenyl)ethanol (PubChem CID 62964280) has the molecular formula C11H13F3O2
and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol |
| PubChem CID | 62964280 |
| Molecular Formula | C11H13F3O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol |
| SMILES | CCCOCC(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H13F3O2/c1-2-5-16-6-9(15)7-3-4-8(12)11(14)10(7)13/h3-4,9,15H,2,5-6H2,1H3 |
| InChIKey | HIAZWFABDCEOJX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol?
The IUPAC name of 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol (CID 62964280) is 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol.
What is the SMILES notation for 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol?
The canonical SMILES for 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol is CCCOCC(O)c1ccc(F)c(F)c1F.
What is the InChIKey of 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol?
The InChIKey is HIAZWFABDCEOJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3O2/c1-2-5-16-6-9(15)7-3-4-8(12)11(14)10(7)13/h3-4,9,15H,2,5-6H2,1H3.
What are the key properties of 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol?
2-propoxy-1-(2,3,4-trifluorophenyl)ethanol has a molecular weight of 234.22 g/mol, XLogP of 2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxy-1-(2,3,4-trifluorophenyl)ethanol is sourced from PubChem (CID 62964280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).