C13H17N3O4 — CID 62964312
3-methyl-5-oxo-5-(pyridin-4-ylmethylcarbamoylamino)pentanoic acid (PubChem CID 62964312) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-methyl-5-oxo-5-(pyridin-4-ylmethylcarbamoylamino)pentanoic acid.
| Compound Name | 3-methyl-5-oxo-5-(pyridin-4-ylmethylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 62964312 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-methyl-5-oxo-5-(pyridin-4-ylmethylcarbamoylamino)pentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)NC(=O)NCc1ccncc1 |
| InChI | InChI=1S/C13H17N3O4/c1-9(7-12(18)19)6-11(17)16-13(20)15-8-10-2-4-14-5-3-10/h2-5,9H,6-8H2,1H3,(H,18,19)(H2,15,16,17,20) |
| InChIKey | GJOZUMVALCPHTJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |