About N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine
N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine (PubChem CID 62965835) has the molecular formula C12H14F3N
and a molecular weight of 229.24 g/mol. Its IUPAC name is N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine.
Molecular Properties
| Compound Name | N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine |
| PubChem CID | 62965835 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine |
| SMILES | CNC1CCCC1c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H14F3N/c1-16-10-4-2-3-7(10)8-5-6-9(13)12(15)11(8)14/h5-7,10,16H,2-4H2,1H3 |
| InChIKey | PIHPBPRZUYJQKA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine?
The IUPAC name of N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine (CID 62965835) is N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine.
What is the SMILES notation for N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine?
The canonical SMILES for N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine is CNC1CCCC1c1ccc(F)c(F)c1F.
What is the InChIKey of N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine?
The InChIKey is PIHPBPRZUYJQKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N/c1-16-10-4-2-3-7(10)8-5-6-9(13)12(15)11(8)14/h5-7,10,16H,2-4H2,1H3.
What are the key properties of N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine?
N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine has a molecular weight of 229.24 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(2,3,4-trifluorophenyl)cyclopentan-1-amine is sourced from PubChem (CID 62965835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).