C5H4F7I — CID 629659
1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane (PubChem CID 629659) has the molecular formula C5H4F7I and a molecular weight of 323.98 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane.
| Compound Name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane |
|---|---|
| PubChem CID | 629659 |
| Molecular Formula | C5H4F7I |
| Molecular Weight | 323.98 g/mol |
| Exact Mass | 323.92 |
| IUPAC Name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane |
| SMILES | FC(F)(F)C(F)(CCI)C(F)(F)F |
| InChI | InChI=1S/C5H4F7I/c6-3(1-2-13,4(7,8)9)5(10,11)12/h1-2H2 |
| InChIKey | NRVDKMYDLZBFEH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.98 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|