About N-tert-butyl-2-chloro-4,4-dimethylpentanamide
N-tert-butyl-2-chloro-4,4-dimethylpentanamide (PubChem CID 62966362) has the molecular formula C11H22ClNO
and a molecular weight of 219.76 g/mol. Its IUPAC name is N-tert-butyl-2-chloro-4,4-dimethylpentanamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-chloro-4,4-dimethylpentanamide |
| PubChem CID | 62966362 |
| Molecular Formula | C11H22ClNO |
| Molecular Weight | 219.76 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-tert-butyl-2-chloro-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(Cl)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H22ClNO/c1-10(2,3)7-8(12)9(14)13-11(4,5)6/h8H,7H2,1-6H3,(H,13,14) |
| InChIKey | QNLITHGBTSHDCU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2-chloro-4,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-chloro-4,4-dimethylpentanamide?
The IUPAC name of N-tert-butyl-2-chloro-4,4-dimethylpentanamide (CID 62966362) is N-tert-butyl-2-chloro-4,4-dimethylpentanamide.
What is the SMILES notation for N-tert-butyl-2-chloro-4,4-dimethylpentanamide?
The canonical SMILES for N-tert-butyl-2-chloro-4,4-dimethylpentanamide is CC(C)(C)CC(Cl)C(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-2-chloro-4,4-dimethylpentanamide?
The InChIKey is QNLITHGBTSHDCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22ClNO/c1-10(2,3)7-8(12)9(14)13-11(4,5)6/h8H,7H2,1-6H3,(H,13,14).
What are the key properties of N-tert-butyl-2-chloro-4,4-dimethylpentanamide?
N-tert-butyl-2-chloro-4,4-dimethylpentanamide has a molecular weight of 219.76 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-chloro-4,4-dimethylpentanamide is sourced from PubChem (CID 62966362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).