About 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide
2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide (PubChem CID 62967010) has the molecular formula C8H15F3N4
and a molecular weight of 224.23 g/mol. Its IUPAC name is 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide.
Molecular Properties
| Compound Name | 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide |
| PubChem CID | 62967010 |
| Molecular Formula | C8H15F3N4 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide |
| SMILES | [H]/N=C(\N)CN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C8H15F3N4/c9-8(10,11)6-15-3-1-14(2-4-15)5-7(12)13/h1-6H2,(H3,12,13) |
| InChIKey | UWSBQNUODUJIHZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide?
The IUPAC name of 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide (CID 62967010) is 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide.
What is the SMILES notation for 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide?
The canonical SMILES for 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide is [H]/N=C(\N)CN1CCN(CC(F)(F)F)CC1.
What is the InChIKey of 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide?
The InChIKey is UWSBQNUODUJIHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N4/c9-8(10,11)6-15-3-1-14(2-4-15)5-7(12)13/h1-6H2,(H3,12,13).
What are the key properties of 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide?
2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide has a molecular weight of 224.23 g/mol, XLogP of 0.10, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanimidamide is sourced from PubChem (CID 62967010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).