C17H22N2OS — CID 62967037
N-[(3-carbamothioylphenyl)methyl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 62967037) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is N-[(3-carbamothioylphenyl)methyl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-[(3-carbamothioylphenyl)methyl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 62967037 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-[(3-carbamothioylphenyl)methyl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CN(Cc1cccc(C(N)=S)c1)C(=O)C1CC2CCC1C2 |
| InChI | InChI=1S/C17H22N2OS/c1-19(10-12-3-2-4-14(8-12)16(18)21)17(20)15-9-11-5-6-13(15)7-11/h2-4,8,11,13,15H,5-7,9-10H2,1H3,(H2,18,21) |
| InChIKey | HTHBHAGLMXSPNX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|