About N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine
N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine (PubChem CID 62967065) has the molecular formula C12H21F3N6
and a molecular weight of 306.34 g/mol. Its IUPAC name is N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine |
| PubChem CID | 62967065 |
| Molecular Formula | C12H21F3N6 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine |
| SMILES | CNCc1cn(CCN2CCN(CC(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C12H21F3N6/c1-16-8-11-9-21(18-17-11)7-6-19-2-4-20(5-3-19)10-12(13,14)15/h9,16H,2-8,10H2,1H3 |
| InChIKey | LCOXHSFHSIIFFP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine?
The IUPAC name of N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine (CID 62967065) is N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine.
What is the SMILES notation for N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine?
The canonical SMILES for N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine is CNCc1cn(CCN2CCN(CC(F)(F)F)CC2)nn1.
What is the InChIKey of N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine?
The InChIKey is LCOXHSFHSIIFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N6/c1-16-8-11-9-21(18-17-11)7-6-19-2-4-20(5-3-19)10-12(13,14)15/h9,16H,2-8,10H2,1H3.
What are the key properties of N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine?
N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine has a molecular weight of 306.34 g/mol, XLogP of 0.18, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine is sourced from PubChem (CID 62967065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).