About [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine
[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine (PubChem CID 62967069) has the molecular formula C11H19F3N6
and a molecular weight of 292.31 g/mol. Its IUPAC name is [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine |
| PubChem CID | 62967069 |
| Molecular Formula | C11H19F3N6 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine |
| SMILES | NCc1cn(CCN2CCN(CC(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C11H19F3N6/c12-11(13,14)9-19-3-1-18(2-4-19)5-6-20-8-10(7-15)16-17-20/h8H,1-7,9,15H2 |
| InChIKey | NEGPGXYTVUVOCY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine?
The IUPAC name of [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine (CID 62967069) is [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine.
What is the SMILES notation for [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine?
The canonical SMILES for [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine is NCc1cn(CCN2CCN(CC(F)(F)F)CC2)nn1.
What is the InChIKey of [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine?
The InChIKey is NEGPGXYTVUVOCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N6/c12-11(13,14)9-19-3-1-18(2-4-19)5-6-20-8-10(7-15)16-17-20/h8H,1-7,9,15H2.
What are the key properties of [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine?
[1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine has a molecular weight of 292.31 g/mol, XLogP of -0.08, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]triazol-4-yl]methanamine is sourced from PubChem (CID 62967069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).