C13H21F3N4S — CID 62967414
N-[[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 62967414) has the molecular formula C13H21F3N4S and a molecular weight of 322.40 g/mol. Its IUPAC name is N-[[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62967414 |
| Molecular Formula | C13H21F3N4S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(N2CCN(CC(F)(F)F)CC2)s1 |
| InChI | InChI=1S/C13H21F3N4S/c1-2-3-17-8-11-9-18-12(21-11)20-6-4-19(5-7-20)10-13(14,15)16/h9,17H,2-8,10H2,1H3 |
| InChIKey | QXUVWOPQYXHSRG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|