About N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide
N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide (PubChem CID 62967568) has the molecular formula C11H21F3N4
and a molecular weight of 266.31 g/mol. Its IUPAC name is N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
| PubChem CID | 62967568 |
| Molecular Formula | C11H21F3N4 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
| SMILES | CC(C)(C)/N=C(\N)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H21F3N4/c1-10(2,3)16-9(15)18-6-4-17(5-7-18)8-11(12,13)14/h4-8H2,1-3H3,(H2,15,16) |
| InChIKey | KNDUAKVIGZKTQF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide?
The IUPAC name of N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide (CID 62967568) is N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide.
What is the SMILES notation for N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide?
The canonical SMILES for N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide is CC(C)(C)/N=C(\N)N1CCN(CC(F)(F)F)CC1.
What is the InChIKey of N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide?
The InChIKey is KNDUAKVIGZKTQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N4/c1-10(2,3)16-9(15)18-6-4-17(5-7-18)8-11(12,13)14/h4-8H2,1-3H3,(H2,15,16).
What are the key properties of N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide?
N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide has a molecular weight of 266.31 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide is sourced from PubChem (CID 62967568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).