About 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid
1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid (PubChem CID 62967574) has the molecular formula C14H23F3N2O2
and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 62967574 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(CN2CCN(CC(F)(F)F)CC2)CCCCC1 |
| InChI | InChI=1S/C14H23F3N2O2/c15-14(16,17)11-19-8-6-18(7-9-19)10-13(12(20)21)4-2-1-3-5-13/h1-11H2,(H,20,21) |
| InChIKey | DJWQNZLJOCVTRZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid (CID 62967574) is 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid is O=C(O)C1(CN2CCN(CC(F)(F)F)CC2)CCCCC1.
What is the InChIKey of 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid?
The InChIKey is DJWQNZLJOCVTRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F3N2O2/c15-14(16,17)11-19-8-6-18(7-9-19)10-13(12(20)21)4-2-1-3-5-13/h1-11H2,(H,20,21).
What are the key properties of 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid?
1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid has a molecular weight of 308.34 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 62967574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).