About 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol
4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol (PubChem CID 62967741) has the molecular formula C15H27F3N2O
and a molecular weight of 308.39 g/mol. Its IUPAC name is 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol |
| PubChem CID | 62967741 |
| Molecular Formula | C15H27F3N2O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol |
| SMILES | CCC1CCC(O)C(CN2CCN(CC(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C15H27F3N2O/c1-2-12-3-4-14(21)13(9-12)10-19-5-7-20(8-6-19)11-15(16,17)18/h12-14,21H,2-11H2,1H3 |
| InChIKey | QQYQZZSJTQMVCL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol?
The IUPAC name of 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol (CID 62967741) is 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol.
What is the SMILES notation for 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol?
The canonical SMILES for 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol is CCC1CCC(O)C(CN2CCN(CC(F)(F)F)CC2)C1.
What is the InChIKey of 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol?
The InChIKey is QQYQZZSJTQMVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27F3N2O/c1-2-12-3-4-14(21)13(9-12)10-19-5-7-20(8-6-19)11-15(16,17)18/h12-14,21H,2-11H2,1H3.
What are the key properties of 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol?
4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol has a molecular weight of 308.39 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]cyclohexan-1-ol is sourced from PubChem (CID 62967741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).