About 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane
4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane (PubChem CID 62967987) has the molecular formula C11H15FN2O
and a molecular weight of 210.25 g/mol. Its IUPAC name is 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane |
| PubChem CID | 62967987 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane |
| SMILES | CC1CN(c2cccc(F)n2)CCCO1 |
| InChI | InChI=1S/C11H15FN2O/c1-9-8-14(6-3-7-15-9)11-5-2-4-10(12)13-11/h2,4-5,9H,3,6-8H2,1H3 |
| InChIKey | MLCIMERNGBXSKQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane?
The IUPAC name of 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane (CID 62967987) is 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane.
What is the SMILES notation for 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane?
The canonical SMILES for 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane is CC1CN(c2cccc(F)n2)CCCO1.
What is the InChIKey of 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane?
The InChIKey is MLCIMERNGBXSKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2O/c1-9-8-14(6-3-7-15-9)11-5-2-4-10(12)13-11/h2,4-5,9H,3,6-8H2,1H3.
What are the key properties of 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane?
4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane has a molecular weight of 210.25 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-fluoro-2-pyridinyl)-2-methyl-1,4-oxazepane is sourced from PubChem (CID 62967987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).