About 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide
2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide (PubChem CID 62968259) has the molecular formula C12H23F3N4O
and a molecular weight of 296.34 g/mol. Its IUPAC name is 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide.
Molecular Properties
| Compound Name | 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide |
| PubChem CID | 62968259 |
| Molecular Formula | C12H23F3N4O |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide |
| SMILES | CCCNC(CN1CCN(CC(F)(F)F)CC1)C(N)=O |
| InChI | InChI=1S/C12H23F3N4O/c1-2-3-17-10(11(16)20)8-18-4-6-19(7-5-18)9-12(13,14)15/h10,17H,2-9H2,1H3,(H2,16,20) |
| InChIKey | PPAKYFQUZWMBGI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide?
The IUPAC name of 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide (CID 62968259) is 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide.
What is the SMILES notation for 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide?
The canonical SMILES for 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide is CCCNC(CN1CCN(CC(F)(F)F)CC1)C(N)=O.
What is the InChIKey of 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide?
The InChIKey is PPAKYFQUZWMBGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F3N4O/c1-2-3-17-10(11(16)20)8-18-4-6-19(7-5-18)9-12(13,14)15/h10,17H,2-9H2,1H3,(H2,16,20).
What are the key properties of 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide?
2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide has a molecular weight of 296.34 g/mol, XLogP of 0.02, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanamide is sourced from PubChem (CID 62968259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).