C13H21N3O — CID 62968313
2-(1,4-oxazepan-4-yl)-N-(pyridin-3-ylmethyl)ethanamine (PubChem CID 62968313) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(1,4-oxazepan-4-yl)-N-(pyridin-3-ylmethyl)ethanamine.
| Compound Name | 2-(1,4-oxazepan-4-yl)-N-(pyridin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62968313 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-(1,4-oxazepan-4-yl)-N-(pyridin-3-ylmethyl)ethanamine |
| SMILES | c1cncc(CNCCN2CCCOCC2)c1 |
| InChI | InChI=1S/C13H21N3O/c1-3-13(11-14-4-1)12-15-5-7-16-6-2-9-17-10-8-16/h1,3-4,11,15H,2,5-10,12H2 |
| InChIKey | SCRQFQHBCYPUPH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|