About [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine
[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine (PubChem CID 62968966) has the molecular formula C11H16F3N5
and a molecular weight of 275.28 g/mol. Its IUPAC name is [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine.
Molecular Properties
| Compound Name | [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine |
| PubChem CID | 62968966 |
| Molecular Formula | C11H16F3N5 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine |
| SMILES | NCc1ccc(N2CCN(CC(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C11H16F3N5/c12-11(13,14)8-18-3-5-19(6-4-18)10-2-1-9(7-15)16-17-10/h1-2H,3-8,15H2 |
| InChIKey | NMSYSKNNROBYCY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine?
The IUPAC name of [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine (CID 62968966) is [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine.
What is the SMILES notation for [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine?
The canonical SMILES for [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine is NCc1ccc(N2CCN(CC(F)(F)F)CC2)nn1.
What is the InChIKey of [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine?
The InChIKey is NMSYSKNNROBYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N5/c12-11(13,14)8-18-3-5-19(6-4-18)10-2-1-9(7-15)16-17-10/h1-2H,3-8,15H2.
What are the key properties of [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine?
[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine has a molecular weight of 275.28 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridazin-3-yl]methanamine is sourced from PubChem (CID 62968966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).