About N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine
N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine (PubChem CID 62969155) has the molecular formula C14H26F3N3O
and a molecular weight of 309.38 g/mol. Its IUPAC name is N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine |
| PubChem CID | 62969155 |
| Molecular Formula | C14H26F3N3O |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine |
| SMILES | CCNCC1CCC(CN2CCN(CC(F)(F)F)CC2)O1 |
| InChI | InChI=1S/C14H26F3N3O/c1-2-18-9-12-3-4-13(21-12)10-19-5-7-20(8-6-19)11-14(15,16)17/h12-13,18H,2-11H2,1H3 |
| InChIKey | BYIKAMCXGZVXAT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine?
The IUPAC name of N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine (CID 62969155) is N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine.
What is the SMILES notation for N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine?
The canonical SMILES for N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine is CCNCC1CCC(CN2CCN(CC(F)(F)F)CC2)O1.
What is the InChIKey of N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine?
The InChIKey is BYIKAMCXGZVXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F3N3O/c1-2-18-9-12-3-4-13(21-12)10-19-5-7-20(8-6-19)11-14(15,16)17/h12-13,18H,2-11H2,1H3.
What are the key properties of N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine?
N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine has a molecular weight of 309.38 g/mol, XLogP of 1.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]oxolan-2-yl]methyl]ethanamine is sourced from PubChem (CID 62969155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).