C12H15ClF3N3OS — CID 62969696
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanone (PubChem CID 62969696) has the molecular formula C12H15ClF3N3OS and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 62969696 |
| Molecular Formula | C12H15ClF3N3OS |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1nc(CCl)cs1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H15ClF3N3OS/c13-6-9-7-21-10(17-9)5-11(20)19-3-1-18(2-4-19)8-12(14,15)16/h7H,1-6,8H2 |
| InChIKey | HUGLXZANVFUPEE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|