C15H12Cl2N2OS — CID 62969759
N-(3-carbamothioylphenyl)-3,4-dichloro-N-methylbenzamide (PubChem CID 62969759) has the molecular formula C15H12Cl2N2OS and a molecular weight of 339.25 g/mol. Its IUPAC name is N-(3-carbamothioylphenyl)-3,4-dichloro-N-methylbenzamide.
| Compound Name | N-(3-carbamothioylphenyl)-3,4-dichloro-N-methylbenzamide |
|---|---|
| PubChem CID | 62969759 |
| Molecular Formula | C15H12Cl2N2OS |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | N-(3-carbamothioylphenyl)-3,4-dichloro-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Cl)c(Cl)c1)c1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C15H12Cl2N2OS/c1-19(11-4-2-3-9(7-11)14(18)21)15(20)10-5-6-12(16)13(17)8-10/h2-8H,1H3,(H2,18,21) |
| InChIKey | PWINNIJAHYLVHM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|