C12H16N4O2S — CID 62970909
2-(3-carbamothioyl-N-methylanilino)-N-carbamoylpropanamide (PubChem CID 62970909) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-(3-carbamothioyl-N-methylanilino)-N-carbamoylpropanamide.
| Compound Name | 2-(3-carbamothioyl-N-methylanilino)-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 62970909 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-(3-carbamothioyl-N-methylanilino)-N-carbamoylpropanamide |
| SMILES | CC(C(=O)NC(N)=O)N(C)c1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C12H16N4O2S/c1-7(11(17)15-12(14)18)16(2)9-5-3-4-8(6-9)10(13)19/h3-7H,1-2H3,(H2,13,19)(H3,14,15,17,18) |
| InChIKey | VQXBMXSLEUSQIZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|