About [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol
[3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol (PubChem CID 62972334) has the molecular formula C13H18FNO2
and a molecular weight of 239.29 g/mol. Its IUPAC name is [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol |
| PubChem CID | 62972334 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol |
| SMILES | CC1CN(c2ccc(CO)cc2F)CCCO1 |
| InChI | InChI=1S/C13H18FNO2/c1-10-8-15(5-2-6-17-10)13-4-3-11(9-16)7-12(13)14/h3-4,7,10,16H,2,5-6,8-9H2,1H3 |
| InChIKey | KQTIJZJVBMHJIJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol?
The IUPAC name of [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol (CID 62972334) is [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol.
What is the SMILES notation for [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol?
The canonical SMILES for [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol is CC1CN(c2ccc(CO)cc2F)CCCO1.
What is the InChIKey of [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol?
The InChIKey is KQTIJZJVBMHJIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO2/c1-10-8-15(5-2-6-17-10)13-4-3-11(9-16)7-12(13)14/h3-4,7,10,16H,2,5-6,8-9H2,1H3.
What are the key properties of [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol?
[3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol has a molecular weight of 239.29 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanol is sourced from PubChem (CID 62972334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).