C11H20N2O2 — CID 62972370
3-(cyclopropylamino)-1-(1,4-oxazepan-4-yl)propan-1-one (PubChem CID 62972370) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-(cyclopropylamino)-1-(1,4-oxazepan-4-yl)propan-1-one.
| Compound Name | 3-(cyclopropylamino)-1-(1,4-oxazepan-4-yl)propan-1-one |
|---|---|
| PubChem CID | 62972370 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 3-(cyclopropylamino)-1-(1,4-oxazepan-4-yl)propan-1-one |
| SMILES | O=C(CCNC1CC1)N1CCCOCC1 |
| InChI | InChI=1S/C11H20N2O2/c14-11(4-5-12-10-2-3-10)13-6-1-8-15-9-7-13/h10,12H,1-9H2 |
| InChIKey | UGAGNFCCDJYOLE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |