C11H14Cl2N2O — CID 62972939
4-[3-chloro-5-(chloromethyl)-2-pyridinyl]-1,4-oxazepane (PubChem CID 62972939) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is 4-[3-chloro-5-(chloromethyl)-2-pyridinyl]-1,4-oxazepane.
| Compound Name | 4-[3-chloro-5-(chloromethyl)-2-pyridinyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 62972939 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-[3-chloro-5-(chloromethyl)-2-pyridinyl]-1,4-oxazepane |
| SMILES | ClCc1cnc(N2CCCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O/c12-7-9-6-10(13)11(14-8-9)15-2-1-4-16-5-3-15/h6,8H,1-5,7H2 |
| InChIKey | GFAGBFZYEBSQKJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|