C12H19N3O — CID 62973167
N-methyl-3-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine (PubChem CID 62973167) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N-methyl-3-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine.
| Compound Name | N-methyl-3-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62973167 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-methyl-3-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine |
| SMILES | CNc1ncccc1CN1CCCOCC1 |
| InChI | InChI=1S/C12H19N3O/c1-13-12-11(4-2-5-14-12)10-15-6-3-8-16-9-7-15/h2,4-5H,3,6-10H2,1H3,(H,13,14) |
| InChIKey | GWBWBLLDKQMFQF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |