6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid

C10H13N3O3 — CID 62973875

IUPAC6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid
SMILESO=C(O)c1ccc(N2CCCOCC2)nn1
InChIInChI=1S/C10H13N3O3/c14-10(15)8-2-3-9(12-11-8)13-4-1-6-16-7-5-13/h2-3H,1,4-7H2,(H,14,15)
InChIKeyDZWNJRDROXJILC-UHFFFAOYSA-N
MW223.23 g/mol
LogP0.40
Rot. Bonds2

About 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid

6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid (PubChem CID 62973875) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid.

Molecular Properties

Compound Name6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid
PubChem CID62973875
Molecular FormulaC10H13N3O3
Molecular Weight223.23 g/mol
Exact Mass223.10
IUPAC Name6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid
SMILESO=C(O)c1ccc(N2CCCOCC2)nn1
InChIInChI=1S/C10H13N3O3/c14-10(15)8-2-3-9(12-11-8)13-4-1-6-16-7-5-13/h2-3H,1,4-7H2,(H,14,15)
InChIKeyDZWNJRDROXJILC-UHFFFAOYSA-N
XLogP0.40
TPSA75.55 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.23
LogP ≤ 50.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid?
The IUPAC name of 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid (CID 62973875) is 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid.
What is the SMILES notation for 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid?
The canonical SMILES for 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid is O=C(O)c1ccc(N2CCCOCC2)nn1.
What is the InChIKey of 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid?
The InChIKey is DZWNJRDROXJILC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O3/c14-10(15)8-2-3-9(12-11-8)13-4-1-6-16-7-5-13/h2-3H,1,4-7H2,(H,14,15).
What are the key properties of 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid?
6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid has a molecular weight of 223.23 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,4-oxazepan-4-yl)pyridazine-3-carboxylic acid is sourced from PubChem (CID 62973875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).