About [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine
[5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine (PubChem CID 62974112) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine |
| PubChem CID | 62974112 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine |
| SMILES | CC1CN(CC2CCC(CN)O2)CCCO1 |
| InChI | InChI=1S/C12H24N2O2/c1-10-8-14(5-2-6-15-10)9-12-4-3-11(7-13)16-12/h10-12H,2-9,13H2,1H3 |
| InChIKey | VCGSVGQMLOXIML-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine?
The IUPAC name of [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine (CID 62974112) is [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine.
What is the SMILES notation for [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine?
The canonical SMILES for [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine is CC1CN(CC2CCC(CN)O2)CCCO1.
What is the InChIKey of [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine?
The InChIKey is VCGSVGQMLOXIML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-10-8-14(5-2-6-15-10)9-12-4-3-11(7-13)16-12/h10-12H,2-9,13H2,1H3.
What are the key properties of [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine?
[5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine has a molecular weight of 228.34 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2-methyl-1,4-oxazepan-4-yl)methyl]oxolan-2-yl]methanamine is sourced from PubChem (CID 62974112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).