C15H24N2O — CID 62974479
N-[[3-(1,4-oxazepan-4-ylmethyl)phenyl]methyl]ethanamine (PubChem CID 62974479) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N-[[3-(1,4-oxazepan-4-ylmethyl)phenyl]methyl]ethanamine.
| Compound Name | N-[[3-(1,4-oxazepan-4-ylmethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 62974479 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N-[[3-(1,4-oxazepan-4-ylmethyl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cccc(CN2CCCOCC2)c1 |
| InChI | InChI=1S/C15H24N2O/c1-2-16-12-14-5-3-6-15(11-14)13-17-7-4-9-18-10-8-17/h3,5-6,11,16H,2,4,7-10,12-13H2,1H3 |
| InChIKey | WEIWMTKUODOUEQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |