C12H19N3 — CID 62975524
2-N-[2-[cyclopropyl(methyl)amino]ethyl]benzene-1,2-diamine (PubChem CID 62975524) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 2-N-[2-[cyclopropyl(methyl)amino]ethyl]benzene-1,2-diamine.
| Compound Name | 2-N-[2-[cyclopropyl(methyl)amino]ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 62975524 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 2-N-[2-[cyclopropyl(methyl)amino]ethyl]benzene-1,2-diamine |
| SMILES | CN(CCNc1ccccc1N)C1CC1 |
| InChI | InChI=1S/C12H19N3/c1-15(10-6-7-10)9-8-14-12-5-3-2-4-11(12)13/h2-5,10,14H,6-9,13H2,1H3 |
| InChIKey | UCNOLCFFYUGMTF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|