About ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate
ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate (PubChem CID 62976410) has the molecular formula C13H25N3O2
and a molecular weight of 255.36 g/mol. Its IUPAC name is ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate.
Analyze ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate?
The IUPAC name of ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate (CID 62976410) is ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate.
What is the SMILES notation for ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate?
The canonical SMILES for ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate is CCOC(=O)C1(N2CCCNCC2)CCN(C)C1.
What is the InChIKey of ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate?
The InChIKey is BQGCOQJKMBSKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O2/c1-3-18-12(17)13(5-9-15(2)11-13)16-8-4-6-14-7-10-16/h14H,3-11H2,1-2H3.
What are the key properties of ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate?
ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate has a molecular weight of 255.36 g/mol, XLogP of -0.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(1,4-diazepan-1-yl)-1-methylpyrrolidine-3-carboxylate is sourced from PubChem (CID 62976410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).