C17H23ClN2 — CID 62977935
2-[1-(3-chlorophenyl)ethyl-methylamino]cycloheptane-1-carbonitrile (PubChem CID 62977935) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)ethyl-methylamino]cycloheptane-1-carbonitrile.
| Compound Name | 2-[1-(3-chlorophenyl)ethyl-methylamino]cycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 62977935 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[1-(3-chlorophenyl)ethyl-methylamino]cycloheptane-1-carbonitrile |
| SMILES | CC(c1cccc(Cl)c1)N(C)C1CCCCCC1C#N |
| InChI | InChI=1S/C17H23ClN2/c1-13(14-8-6-9-16(18)11-14)20(2)17-10-5-3-4-7-15(17)12-19/h6,8-9,11,13,15,17H,3-5,7,10H2,1-2H3 |
| InChIKey | JFKXAGZZUPAWIN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |