C16H17ClN2O2 — CID 62979439
2-amino-5-[1-(2-chlorophenyl)ethyl-methylamino]benzoic acid (PubChem CID 62979439) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 2-amino-5-[1-(2-chlorophenyl)ethyl-methylamino]benzoic acid.
| Compound Name | 2-amino-5-[1-(2-chlorophenyl)ethyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 62979439 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-amino-5-[1-(2-chlorophenyl)ethyl-methylamino]benzoic acid |
| SMILES | CC(c1ccccc1Cl)N(C)c1ccc(N)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H17ClN2O2/c1-10(12-5-3-4-6-14(12)17)19(2)11-7-8-15(18)13(9-11)16(20)21/h3-10H,18H2,1-2H3,(H,20,21) |
| InChIKey | QRAZJMSDLANALV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|