C14H22ClN3O2S — CID 62979528
N-[1-(4-chlorophenyl)ethyl]-N-methyl-1,4-diazepane-1-sulfonamide (PubChem CID 62979528) has the molecular formula C14H22ClN3O2S and a molecular weight of 331.87 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-N-methyl-1,4-diazepane-1-sulfonamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-N-methyl-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 62979528 |
| Molecular Formula | C14H22ClN3O2S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-N-methyl-1,4-diazepane-1-sulfonamide |
| SMILES | CC(c1ccc(Cl)cc1)N(C)S(=O)(=O)N1CCCNCC1 |
| InChI | InChI=1S/C14H22ClN3O2S/c1-12(13-4-6-14(15)7-5-13)17(2)21(19,20)18-10-3-8-16-9-11-18/h4-7,12,16H,3,8-11H2,1-2H3 |
| InChIKey | FFHOXVBPZVPWPK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |