About N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine
N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine (PubChem CID 62980641) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine |
| PubChem CID | 62980641 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine |
| SMILES | CN(CCNc1cnccn1)C1CC1 |
| InChI | InChI=1S/C10H16N4/c1-14(9-2-3-9)7-6-13-10-8-11-4-5-12-10/h4-5,8-9H,2-3,6-7H2,1H3,(H,12,13) |
| InChIKey | PAZYGUKRZFROGC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine?
The IUPAC name of N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine (CID 62980641) is N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine.
What is the SMILES notation for N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine?
The canonical SMILES for N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine is CN(CCNc1cnccn1)C1CC1.
What is the InChIKey of N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine?
The InChIKey is PAZYGUKRZFROGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c1-14(9-2-3-9)7-6-13-10-8-11-4-5-12-10/h4-5,8-9H,2-3,6-7H2,1H3,(H,12,13).
What are the key properties of N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine?
N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine has a molecular weight of 192.27 g/mol, XLogP of 0.98, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N'-methyl-N-pyrazin-2-ylethane-1,2-diamine is sourced from PubChem (CID 62980641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).