C15H18ClN3 — CID 62980697
3-(aminomethyl)-N-[1-(2-chlorophenyl)ethyl]-N-methylpyridin-2-amine (PubChem CID 62980697) has the molecular formula C15H18ClN3 and a molecular weight of 275.78 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[1-(2-chlorophenyl)ethyl]-N-methylpyridin-2-amine.
| Compound Name | 3-(aminomethyl)-N-[1-(2-chlorophenyl)ethyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 62980697 |
| Molecular Formula | C15H18ClN3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-(aminomethyl)-N-[1-(2-chlorophenyl)ethyl]-N-methylpyridin-2-amine |
| SMILES | CC(c1ccccc1Cl)N(C)c1ncccc1CN |
| InChI | InChI=1S/C15H18ClN3/c1-11(13-7-3-4-8-14(13)16)19(2)15-12(10-17)6-5-9-18-15/h3-9,11H,10,17H2,1-2H3 |
| InChIKey | HCHRGMLNOFLFLC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |