C15H15N5O — CID 62983154
5-amino-2-[(3-cyanophenyl)methyl-methylamino]pyridine-3-carboxamide (PubChem CID 62983154) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 5-amino-2-[(3-cyanophenyl)methyl-methylamino]pyridine-3-carboxamide.
| Compound Name | 5-amino-2-[(3-cyanophenyl)methyl-methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62983154 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 5-amino-2-[(3-cyanophenyl)methyl-methylamino]pyridine-3-carboxamide |
| SMILES | CN(Cc1cccc(C#N)c1)c1ncc(N)cc1C(N)=O |
| InChI | InChI=1S/C15H15N5O/c1-20(9-11-4-2-3-10(5-11)7-16)15-13(14(18)21)6-12(17)8-19-15/h2-6,8H,9,17H2,1H3,(H2,18,21) |
| InChIKey | DUCAYTMPGWAIHG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 109.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |