C17H23ClN2O — CID 62983851
1-(2-chlorophenyl)-N-[[5-(ethylaminomethyl)furan-2-yl]methyl]-N-methylethanamine (PubChem CID 62983851) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[[5-(ethylaminomethyl)furan-2-yl]methyl]-N-methylethanamine.
| Compound Name | 1-(2-chlorophenyl)-N-[[5-(ethylaminomethyl)furan-2-yl]methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 62983851 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[[5-(ethylaminomethyl)furan-2-yl]methyl]-N-methylethanamine |
| SMILES | CCNCc1ccc(CN(C)C(C)c2ccccc2Cl)o1 |
| InChI | InChI=1S/C17H23ClN2O/c1-4-19-11-14-9-10-15(21-14)12-20(3)13(2)16-7-5-6-8-17(16)18/h5-10,13,19H,4,11-12H2,1-3H3 |
| InChIKey | LASADPZKIZNWTH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |