About 6-nitro-2,4-diphenylquinoline
6-nitro-2,4-diphenylquinoline (PubChem CID 629840) has the molecular formula C21H14N2O2
and a molecular weight of 326.36 g/mol. Its IUPAC name is 6-nitro-2,4-diphenylquinoline.
Molecular Properties
| Compound Name | 6-nitro-2,4-diphenylquinoline |
| PubChem CID | 629840 |
| Molecular Formula | C21H14N2O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 6-nitro-2,4-diphenylquinoline |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3ccccc3)cc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H14N2O2/c24-23(25)17-11-12-20-19(13-17)18(15-7-3-1-4-8-15)14-21(22-20)16-9-5-2-6-10-16/h1-14H |
| InChIKey | LXGCTGNEHPKAOP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-2,4-diphenylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-2,4-diphenylquinoline?
The IUPAC name of 6-nitro-2,4-diphenylquinoline (CID 629840) is 6-nitro-2,4-diphenylquinoline.
What is the SMILES notation for 6-nitro-2,4-diphenylquinoline?
The canonical SMILES for 6-nitro-2,4-diphenylquinoline is O=[N+]([O-])c1ccc2nc(-c3ccccc3)cc(-c3ccccc3)c2c1.
What is the InChIKey of 6-nitro-2,4-diphenylquinoline?
The InChIKey is LXGCTGNEHPKAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N2O2/c24-23(25)17-11-12-20-19(13-17)18(15-7-3-1-4-8-15)14-21(22-20)16-9-5-2-6-10-16/h1-14H.
What are the key properties of 6-nitro-2,4-diphenylquinoline?
6-nitro-2,4-diphenylquinoline has a molecular weight of 326.36 g/mol, XLogP of 5.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-2,4-diphenylquinoline is sourced from PubChem (CID 629840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).