C15H24FN3O2 — CID 62984089
N-(5-amino-2-fluorophenyl)-4-[3-methoxypropyl(methyl)amino]butanamide (PubChem CID 62984089) has the molecular formula C15H24FN3O2 and a molecular weight of 297.37 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-4-[3-methoxypropyl(methyl)amino]butanamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-4-[3-methoxypropyl(methyl)amino]butanamide |
|---|---|
| PubChem CID | 62984089 |
| Molecular Formula | C15H24FN3O2 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-4-[3-methoxypropyl(methyl)amino]butanamide |
| SMILES | COCCCN(C)CCCC(=O)Nc1cc(N)ccc1F |
| InChI | InChI=1S/C15H24FN3O2/c1-19(9-4-10-21-2)8-3-5-15(20)18-14-11-12(17)6-7-13(14)16/h6-7,11H,3-5,8-10,17H2,1-2H3,(H,18,20) |
| InChIKey | YIMPRWBOLUVVBF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|