About 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine
3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine (PubChem CID 62985090) has the molecular formula C16H25ClN2
and a molecular weight of 280.84 g/mol. Its IUPAC name is 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine |
| PubChem CID | 62985090 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine |
| SMILES | CC(CCNC1CC1)N(C)C(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H25ClN2/c1-12(10-11-18-16-8-9-16)19(3)13(2)14-4-6-15(17)7-5-14/h4-7,12-13,16,18H,8-11H2,1-3H3 |
| InChIKey | NHIVIFMALNEJHM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine?
The IUPAC name of 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine (CID 62985090) is 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine.
What is the SMILES notation for 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine?
The canonical SMILES for 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine is CC(CCNC1CC1)N(C)C(C)c1ccc(Cl)cc1.
What is the InChIKey of 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine?
The InChIKey is NHIVIFMALNEJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25ClN2/c1-12(10-11-18-16-8-9-16)19(3)13(2)14-4-6-15(17)7-5-14/h4-7,12-13,16,18H,8-11H2,1-3H3.
What are the key properties of 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine?
3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine has a molecular weight of 280.84 g/mol, XLogP of 3.86, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[1-(4-chlorophenyl)ethyl]-1-N-cyclopropyl-3-N-methylbutane-1,3-diamine is sourced from PubChem (CID 62985090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).