About 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one
3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one (PubChem CID 629853) has the molecular formula C18H14O6
and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one |
| PubChem CID | 629853 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(-c3ccc4c(c3)OCO4)coc2c1 |
| InChI | InChI=1S/C18H14O6/c1-20-11-6-15(21-2)17-16(7-11)22-8-12(18(17)19)10-3-4-13-14(5-10)24-9-23-13/h3-8H,9H2,1-2H3 |
| InChIKey | IMPPSJRGMZYGJW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one?
The IUPAC name of 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one (CID 629853) is 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one.
What is the SMILES notation for 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one?
The canonical SMILES for 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one is COc1cc(OC)c2c(=O)c(-c3ccc4c(c3)OCO4)coc2c1.
What is the InChIKey of 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one?
The InChIKey is IMPPSJRGMZYGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O6/c1-20-11-6-15(21-2)17-16(7-11)22-8-12(18(17)19)10-3-4-13-14(5-10)24-9-23-13/h3-8H,9H2,1-2H3.
What are the key properties of 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one?
3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one has a molecular weight of 326.30 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-yl)-5,7-dimethoxychromen-4-one is sourced from PubChem (CID 629853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).