About 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine
1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine (PubChem CID 62985550) has the molecular formula C12H20N2O
and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine |
| PubChem CID | 62985550 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine |
| SMILES | COCCCN(C)c1ccc(N)cc1C |
| InChI | InChI=1S/C12H20N2O/c1-10-9-11(13)5-6-12(10)14(2)7-4-8-15-3/h5-6,9H,4,7-8,13H2,1-3H3 |
| InChIKey | GPAZIMZCOAOOTN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine?
The IUPAC name of 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine (CID 62985550) is 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine.
What is the SMILES notation for 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine?
The canonical SMILES for 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine is COCCCN(C)c1ccc(N)cc1C.
What is the InChIKey of 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine?
The InChIKey is GPAZIMZCOAOOTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-10-9-11(13)5-6-12(10)14(2)7-4-8-15-3/h5-6,9H,4,7-8,13H2,1-3H3.
What are the key properties of 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine?
1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine has a molecular weight of 208.31 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(3-methoxypropyl)-1-N,2-dimethylbenzene-1,4-diamine is sourced from PubChem (CID 62985550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).