C9H17F3N2O — CID 62986698
4,4,4-trifluoro-3-(1,4-oxazepan-4-yl)butan-2-amine (PubChem CID 62986698) has the molecular formula C9H17F3N2O and a molecular weight of 226.24 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(1,4-oxazepan-4-yl)butan-2-amine.
| Compound Name | 4,4,4-trifluoro-3-(1,4-oxazepan-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 62986698 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4,4,4-trifluoro-3-(1,4-oxazepan-4-yl)butan-2-amine |
| SMILES | CC(N)C(N1CCCOCC1)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O/c1-7(13)8(9(10,11)12)14-3-2-5-15-6-4-14/h7-8H,2-6,13H2,1H3 |
| InChIKey | JLESALBCMWDMEO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |