About 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one
4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one (PubChem CID 62986788) has the molecular formula C10H13F3N2O
and a molecular weight of 234.22 g/mol. Its IUPAC name is 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one.
Molecular Properties
| Compound Name | 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one |
| PubChem CID | 62986788 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one |
| SMILES | Cc1ccn(CCNCC(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C10H13F3N2O/c1-8-2-4-15(9(16)6-8)5-3-14-7-10(11,12)13/h2,4,6,14H,3,5,7H2,1H3 |
| InChIKey | HPLXCMOJKTTZDQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one?
The IUPAC name of 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one (CID 62986788) is 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one.
What is the SMILES notation for 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one?
The canonical SMILES for 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one is Cc1ccn(CCNCC(F)(F)F)c(=O)c1.
What is the InChIKey of 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one?
The InChIKey is HPLXCMOJKTTZDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N2O/c1-8-2-4-15(9(16)6-8)5-3-14-7-10(11,12)13/h2,4,6,14H,3,5,7H2,1H3.
What are the key properties of 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one?
4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one has a molecular weight of 234.22 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one is sourced from PubChem (CID 62986788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).